C16H26BN5 — CID 4663662
N,N-dimethyl-13,13-dipropyl-8,10,12-triaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,11-pentaen-11-amine (PubChem CID 4663662) has the molecular formula C16H26BN5 and a molecular weight of 299.23 g/mol. Its IUPAC name is N,N-dimethyl-13,13-dipropyl-8,10,12-triaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,11-pentaen-11-amine.
| Compound Name | N,N-dimethyl-13,13-dipropyl-8,10,12-triaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,11-pentaen-11-amine |
|---|---|
| PubChem CID | 4663662 |
| Molecular Formula | C16H26BN5 |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | N,N-dimethyl-13,13-dipropyl-8,10,12-triaza-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,11-pentaen-11-amine |
| SMILES | CCC[B-]1(CCC)N=C(N(C)C)Nc2[nH]c3ccccc3[n+]21 |
| InChI | InChI=1S/C16H26BN5/c1-5-11-17(12-6-2)20-16(21(3)4)19-15-18-13-9-7-8-10-14(13)22(15)17/h7-10,18H,5-6,11-12H2,1-4H3,(H,19,20) |
| InChIKey | VGGVDZUMTCSYPC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|