C19H22N2O4 — CID 46637977
N-[2-(3,5-dimethylphenoxy)ethyl]-N-methyl-2-(4-nitrophenyl)acetamide (PubChem CID 46637977) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-N-methyl-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-N-methyl-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46637977 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-N-methyl-2-(4-nitrophenyl)acetamide |
| SMILES | Cc1cc(C)cc(OCCN(C)C(=O)Cc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-14-10-15(2)12-18(11-14)25-9-8-20(3)19(22)13-16-4-6-17(7-5-16)21(23)24/h4-7,10-12H,8-9,13H2,1-3H3 |
| InChIKey | ONBBPUZNFIIMEY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|