C29H30N4O12 — CID 87516797
3,5-bis[2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid (PubChem CID 87516797) has the molecular formula C29H30N4O12 and a molecular weight of 626.58 g/mol. Its IUPAC name is 3,5-bis[2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid.
| Compound Name | 3,5-bis[2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 87516797 |
| Molecular Formula | C29H30N4O12 |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 3,5-bis[2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid |
| SMILES | CN(CCOc1cc(OCCN(C)C(=O)OCc2ccc([N+](=O)[O-])cc2)cc(C(=O)O)c1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H30N4O12/c1-30(28(36)44-18-20-3-7-23(8-4-20)32(38)39)11-13-42-25-15-22(27(34)35)16-26(17-25)43-14-12-31(2)29(37)45-19-21-5-9-24(10-6-21)33(40)41/h3-10,15-17H,11-14,18-19H2,1-2H3,(H,34,35) |
| InChIKey | BNSKQSHPNSIHJF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 201.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|