C31H34N4O12 — CID 87516371
3,5-bis[2-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid (PubChem CID 87516371) has the molecular formula C31H34N4O12 and a molecular weight of 654.63 g/mol. Its IUPAC name is 3,5-bis[2-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid.
| Compound Name | 3,5-bis[2-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 87516371 |
| Molecular Formula | C31H34N4O12 |
| Molecular Weight | 654.63 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 3,5-bis[2-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]ethoxy]benzoic acid |
| SMILES | CCN(CCOc1cc(OCCN(CC)C(=O)OCc2ccc([N+](=O)[O-])cc2)cc(C(=O)O)c1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H34N4O12/c1-3-32(30(38)46-20-22-5-9-25(10-6-22)34(40)41)13-15-44-27-17-24(29(36)37)18-28(19-27)45-16-14-33(4-2)31(39)47-21-23-7-11-26(12-8-23)35(42)43/h5-12,17-19H,3-4,13-16,20-21H2,1-2H3,(H,36,37) |
| InChIKey | ZZZOLUPKWOHTLE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 201.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|