C18H16N4O3S — CID 46644066
2-(1H-benzimidazol-2-ylsulfanyl)-1-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 46644066) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-1-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 46644066 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-1-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)N1CCCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H16N4O3S/c23-17(11-26-18-19-14-5-1-2-6-15(14)20-18)21-9-3-4-12-10-13(22(24)25)7-8-16(12)21/h1-2,5-8,10H,3-4,9,11H2,(H,19,20) |
| InChIKey | MLUVZISPGBDEHK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|