C27H32N2O3 — CID 4664528
benzyl N-[1-[4-(1-adamantyl)anilino]-1-oxopropan-2-yl]carbamate (PubChem CID 4664528) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is benzyl N-[1-[4-(1-adamantyl)anilino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[4-(1-adamantyl)anilino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 4664528 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | benzyl N-[1-[4-(1-adamantyl)anilino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H32N2O3/c1-18(28-26(31)32-17-19-5-3-2-4-6-19)25(30)29-24-9-7-23(8-10-24)27-14-20-11-21(15-27)13-22(12-20)16-27/h2-10,18,20-22H,11-17H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | ACRWEFRASNBAMA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |