C19H16ClFN2O4 — CID 46656764
5-chloro-N'-[2-(4-fluorophenoxy)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 46656764) has the molecular formula C19H16ClFN2O4 and a molecular weight of 390.80 g/mol. Its IUPAC name is 5-chloro-N'-[2-(4-fluorophenoxy)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-chloro-N'-[2-(4-fluorophenoxy)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 46656764 |
| Molecular Formula | C19H16ClFN2O4 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 5-chloro-N'-[2-(4-fluorophenoxy)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)C(C)Oc2ccc(F)cc2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H16ClFN2O4/c1-10-15-9-12(20)3-8-16(15)27-17(10)19(25)23-22-18(24)11(2)26-14-6-4-13(21)5-7-14/h3-9,11H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | QCRUZCOHQWTGJA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|