C20H17Cl2N3O4 — CID 46658405
[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 46658405) has the molecular formula C20H17Cl2N3O4 and a molecular weight of 434.28 g/mol. Its IUPAC name is [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 46658405 |
| Molecular Formula | C20H17Cl2N3O4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1c2ccccc2NC(=O)C12CCCC2)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O4/c21-13-9-12(10-23-17(13)22)18(27)29-11-16(26)25-15-6-2-1-5-14(15)24-19(28)20(25)7-3-4-8-20/h1-2,5-6,9-10H,3-4,7-8,11H2,(H,24,28) |
| InChIKey | HBNOGJSGGCKFIF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|