C23H21N3O8 — CID 55459255
1-O-methyl 3-O-[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 55459255) has the molecular formula C23H21N3O8 and a molecular weight of 467.43 g/mol. Its IUPAC name is 1-O-methyl 3-O-[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55459255 |
| Molecular Formula | C23H21N3O8 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-O-methyl 3-O-[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)N2c3ccccc3NC(=O)C23CCCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21N3O8/c1-33-20(28)14-10-15(12-16(11-14)26(31)32)21(29)34-13-19(27)25-18-7-3-2-6-17(18)24-22(30)23(25)8-4-5-9-23/h2-3,6-7,10-12H,4-5,8-9,13H2,1H3,(H,24,30) |
| InChIKey | SLYFYFSWYGXNNA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|