About [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate
[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate (PubChem CID 46666621) has the molecular formula C21H18BrFN2O4
and a molecular weight of 461.29 g/mol. Its IUPAC name is [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate |
| PubChem CID | 46666621 |
| Molecular Formula | C21H18BrFN2O4 |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate |
| SMILES | O=C(OCC(=O)N1c2ccccc2NC(=O)C12CCCC2)c1ccc(F)cc1Br |
| InChI | InChI=1S/C21H18BrFN2O4/c22-15-11-13(23)7-8-14(15)19(27)29-12-18(26)25-17-6-2-1-5-16(17)24-20(28)21(25)9-3-4-10-21/h1-2,5-8,11H,3-4,9-10,12H2,(H,24,28) |
| InChIKey | OGGBHHGFHOBLCF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate?
The IUPAC name of [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate (CID 46666621) is [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate.
What is the SMILES notation for [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate?
The canonical SMILES for [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate is O=C(OCC(=O)N1c2ccccc2NC(=O)C12CCCC2)c1ccc(F)cc1Br.
What is the InChIKey of [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate?
The InChIKey is OGGBHHGFHOBLCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18BrFN2O4/c22-15-11-13(23)7-8-14(15)19(27)29-12-18(26)25-17-6-2-1-5-16(17)24-20(28)21(25)9-3-4-10-21/h1-2,5-8,11H,3-4,9-10,12H2,(H,24,28).
What are the key properties of [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate?
[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate has a molecular weight of 461.29 g/mol, XLogP of 4.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 2-bromo-4-fluorobenzoate is sourced from PubChem (CID 46666621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).