C20H23N5OS — CID 46658757
N-benzyl-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylbutanamide (PubChem CID 46658757) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-benzyl-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylbutanamide.
| Compound Name | N-benzyl-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 46658757 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-benzyl-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylbutanamide |
| SMILES | CCC(Sc1nnnn1-c1cccc(C)c1C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H23N5OS/c1-4-18(19(26)21-13-16-10-6-5-7-11-16)27-20-22-23-24-25(20)17-12-8-9-14(2)15(17)3/h5-12,18H,4,13H2,1-3H3,(H,21,26) |
| InChIKey | PPQNEJKVBOCXCH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |