C21H16N2O5 — CID 46661519
[2-(2-nitroanilino)-2-oxoethyl] 1,2-dihydroacenaphthylene-5-carboxylate (PubChem CID 46661519) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 1,2-dihydroacenaphthylene-5-carboxylate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 1,2-dihydroacenaphthylene-5-carboxylate |
|---|---|
| PubChem CID | 46661519 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 1,2-dihydroacenaphthylene-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c3c(cccc13)CC2)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N2O5/c24-19(22-17-6-1-2-7-18(17)23(26)27)12-28-21(25)16-11-10-14-9-8-13-4-3-5-15(16)20(13)14/h1-7,10-11H,8-9,12H2,(H,22,24) |
| InChIKey | VZDSNAKJTMPOIF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|