C14H21N3O4S — CID 4666152
diethyl 2,5-dimethyl-1-(methylcarbamothioylamino)pyrrole-3,4-dicarboxylate (PubChem CID 4666152) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is diethyl 2,5-dimethyl-1-(methylcarbamothioylamino)pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 2,5-dimethyl-1-(methylcarbamothioylamino)pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 4666152 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | diethyl 2,5-dimethyl-1-(methylcarbamothioylamino)pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c(C)n(NC(=S)NC)c1C |
| InChI | InChI=1S/C14H21N3O4S/c1-6-20-12(18)10-8(3)17(16-14(22)15-5)9(4)11(10)13(19)21-7-2/h6-7H2,1-5H3,(H2,15,16,22) |
| InChIKey | ATTSPLKAAAPBQD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|