C29H31N3O5S2 — CID 4666253
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4666253) has the molecular formula C29H31N3O5S2 and a molecular weight of 565.72 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4666253 |
| Molecular Formula | C29H31N3O5S2 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1cccs1)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C29H31N3O5S2/c1-4-16-32(39(34,35)27-11-5-8-23-9-6-15-30-29(23)27)21-28(33)31(20-24-10-7-18-38-24)17-14-22-12-13-25(36-2)26(19-22)37-3/h4-13,15,18-19H,1,14,16-17,20-21H2,2-3H3 |
| InChIKey | BEBWDCBPBOLSJU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|