C19H16ClFN2O — CID 46665827
N-[1-(3-chlorophenyl)ethyl]-7-fluoro-2-methylquinoline-3-carboxamide (PubChem CID 46665827) has the molecular formula C19H16ClFN2O and a molecular weight of 342.80 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-7-fluoro-2-methylquinoline-3-carboxamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-7-fluoro-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46665827 |
| Molecular Formula | C19H16ClFN2O |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-7-fluoro-2-methylquinoline-3-carboxamide |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)NC(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2O/c1-11(13-4-3-5-15(20)8-13)23-19(24)17-9-14-6-7-16(21)10-18(14)22-12(17)2/h3-11H,1-2H3,(H,23,24) |
| InChIKey | HFJIZBQEWBBROX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |