C20H16BrFN2O3 — CID 51128333
methyl 2-(4-bromophenyl)-2-[(7-fluoro-2-methylquinoline-3-carbonyl)amino]acetate (PubChem CID 51128333) has the molecular formula C20H16BrFN2O3 and a molecular weight of 431.26 g/mol. Its IUPAC name is methyl 2-(4-bromophenyl)-2-[(7-fluoro-2-methylquinoline-3-carbonyl)amino]acetate.
| Compound Name | methyl 2-(4-bromophenyl)-2-[(7-fluoro-2-methylquinoline-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 51128333 |
| Molecular Formula | C20H16BrFN2O3 |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | methyl 2-(4-bromophenyl)-2-[(7-fluoro-2-methylquinoline-3-carbonyl)amino]acetate |
| SMILES | COC(=O)C(NC(=O)c1cc2ccc(F)cc2nc1C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrFN2O3/c1-11-16(9-13-5-8-15(22)10-17(13)23-11)19(25)24-18(20(26)27-2)12-3-6-14(21)7-4-12/h3-10,18H,1-2H3,(H,24,25) |
| InChIKey | FSNQGMCFIGXOSN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |