C21H25N3O7 — CID 46673267
dimethyl 5-[[2-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 46673267) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is dimethyl 5-[[2-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46673267 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | dimethyl 5-[[2-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyloxy]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)CCc2c(C)nn(C)c2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H25N3O7/c1-12-17(13(2)24(3)23-12)6-7-19(26)31-11-18(25)22-16-9-14(20(27)29-4)8-15(10-16)21(28)30-5/h8-10H,6-7,11H2,1-5H3,(H,22,25) |
| InChIKey | NLQDBZPAIXLCBT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|