C24H22F4N4O7S2 — CID 4667743
1-(4-methylphenyl)sulfonyl-3-[3-[(4-methylphenyl)sulfonylcarbamoylamino]-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea (PubChem CID 4667743) has the molecular formula C24H22F4N4O7S2 and a molecular weight of 618.59 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-[3-[(4-methylphenyl)sulfonylcarbamoylamino]-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-[3-[(4-methylphenyl)sulfonylcarbamoylamino]-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 4667743 |
| Molecular Formula | C24H22F4N4O7S2 |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 618.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-[3-[(4-methylphenyl)sulfonylcarbamoylamino]-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(OC(F)(F)C(F)F)c(NC(=O)NS(=O)(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C24H22F4N4O7S2/c1-14-3-8-17(9-4-14)40(35,36)31-22(33)29-16-7-12-20(39-24(27,28)21(25)26)19(13-16)30-23(34)32-41(37,38)18-10-5-15(2)6-11-18/h3-13,21H,1-2H3,(H2,29,31,33)(H2,30,32,34) |
| InChIKey | SUGSAGSVKAPCBM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|