C37H36N6O9S3 — CID 19607119
1-[4-[[2,4-bis[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 19607119) has the molecular formula C37H36N6O9S3 and a molecular weight of 804.93 g/mol. Its IUPAC name is 1-[4-[[2,4-bis[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[4-[[2,4-bis[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 19607119 |
| Molecular Formula | C37H36N6O9S3 |
| Molecular Weight | 804.93 g/mol |
| Exact Mass | 804.17 |
| IUPAC Name | 1-[4-[[2,4-bis[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(Cc3ccc(NC(=O)NS(=O)(=O)c4ccc(C)cc4)cc3NC(=O)NS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H36N6O9S3/c1-24-4-16-31(17-5-24)53(47,48)41-35(44)38-29-13-10-27(11-14-29)22-28-12-15-30(39-36(45)42-54(49,50)32-18-6-25(2)7-19-32)23-34(28)40-37(46)43-55(51,52)33-20-8-26(3)9-21-33/h4-21,23H,22H2,1-3H3,(H2,38,41,44)(H2,39,42,45)(H2,40,43,46) |
| InChIKey | QDUYLVULRBOZCP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 225.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.93 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |