C22H19N3O3 — CID 46680891
2-(4-cyanophenoxy)ethyl 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate (PubChem CID 46680891) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46680891 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
| SMILES | N#Cc1ccc(OCCOC(=O)c2nn(-c3ccccc3)c3c2CCC3)cc1 |
| InChI | InChI=1S/C22H19N3O3/c23-15-16-9-11-18(12-10-16)27-13-14-28-22(26)21-19-7-4-8-20(19)25(24-21)17-5-2-1-3-6-17/h1-3,5-6,9-12H,4,7-8,13-14H2 |
| InChIKey | UQASORYRASJQGY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|