About 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide
2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide (PubChem CID 46683652) has the molecular formula C15H16N4O4S2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide |
| PubChem CID | 46683652 |
| Molecular Formula | C15H16N4O4S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide |
| SMILES | Cc1nc(SCC(=O)N(C)c2ccc([N+](=O)[O-])cc2)sc1CC(N)=O |
| InChI | InChI=1S/C15H16N4O4S2/c1-9-12(7-13(16)20)25-15(17-9)24-8-14(21)18(2)10-3-5-11(6-4-10)19(22)23/h3-6H,7-8H2,1-2H3,(H2,16,20) |
| InChIKey | QVFJHYPLXXGUET-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide?
The IUPAC name of 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide (CID 46683652) is 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide.
What is the SMILES notation for 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide?
The canonical SMILES for 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide is Cc1nc(SCC(=O)N(C)c2ccc([N+](=O)[O-])cc2)sc1CC(N)=O.
What is the InChIKey of 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide?
The InChIKey is QVFJHYPLXXGUET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O4S2/c1-9-12(7-13(16)20)25-15(17-9)24-8-14(21)18(2)10-3-5-11(6-4-10)19(22)23/h3-6H,7-8H2,1-2H3,(H2,16,20).
What are the key properties of 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide?
2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide has a molecular weight of 380.45 g/mol, XLogP of 2.14, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-2-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-5-yl]acetamide is sourced from PubChem (CID 46683652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).