C19H24N4O5S — CID 46686824
2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]acetamide (PubChem CID 46686824) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]acetamide.
| Compound Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 46686824 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)NC2(c3noc(C)n3)CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N4O5S/c1-13-20-18(22-28-13)19(8-4-3-5-9-19)21-17(24)12-29-11-14-6-7-16(27-2)15(10-14)23(25)26/h6-7,10H,3-5,8-9,11-12H2,1-2H3,(H,21,24) |
| InChIKey | ZEXNLRZIBSQTKC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|