C14H14FN3O4 — CID 46687411
(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-amino-4-fluorobenzoate (PubChem CID 46687411) has the molecular formula C14H14FN3O4 and a molecular weight of 307.28 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-amino-4-fluorobenzoate.
| Compound Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 46687411 |
| Molecular Formula | C14H14FN3O4 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-amino-4-fluorobenzoate |
| SMILES | Cn1c(COC(=O)c2ccc(F)cc2N)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H14FN3O4/c1-17-9(6-12(19)18(2)14(17)21)7-22-13(20)10-4-3-8(15)5-11(10)16/h3-6H,7,16H2,1-2H3 |
| InChIKey | WMBOAKXCSYDHMN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|