C19H15ClN4O6 — CID 46687465
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 46687465) has the molecular formula C19H15ClN4O6 and a molecular weight of 430.80 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 46687465 |
| Molecular Formula | C19H15ClN4O6 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1noc2nc(C3CC3)cc(C(=O)OCC(=O)Nc3ccc([N+](=O)[O-])cc3Cl)c12 |
| InChI | InChI=1S/C19H15ClN4O6/c1-9-17-12(7-15(10-2-3-10)22-18(17)30-23-9)19(26)29-8-16(25)21-14-5-4-11(24(27)28)6-13(14)20/h4-7,10H,2-3,8H2,1H3,(H,21,25) |
| InChIKey | FKTFSCUVLOEXJG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|