C22H17ClN4O7 — CID 55485429
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 55485429) has the molecular formula C22H17ClN4O7 and a molecular weight of 484.85 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 55485429 |
| Molecular Formula | C22H17ClN4O7 |
| Molecular Weight | 484.85 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1cc(-c2cc(C(=O)OCC(=O)Nc3ccc(Cl)cc3[N+](=O)[O-])c3c(C)noc3n2)c(C)o1 |
| InChI | InChI=1S/C22H17ClN4O7/c1-10-6-14(12(3)33-10)17-8-15(20-11(2)26-34-21(20)25-17)22(29)32-9-19(28)24-16-5-4-13(23)7-18(16)27(30)31/h4-8H,9H2,1-3H3,(H,24,28) |
| InChIKey | XBNXZKZQLIEAJL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 150.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|