C15H10Cl2F3N3O2 — CID 46687715
N-[4-acetamido-2-(trifluoromethyl)phenyl]-5,6-dichloropyridine-3-carboxamide (PubChem CID 46687715) has the molecular formula C15H10Cl2F3N3O2 and a molecular weight of 392.16 g/mol. Its IUPAC name is N-[4-acetamido-2-(trifluoromethyl)phenyl]-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[4-acetamido-2-(trifluoromethyl)phenyl]-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 46687715 |
| Molecular Formula | C15H10Cl2F3N3O2 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-[4-acetamido-2-(trifluoromethyl)phenyl]-5,6-dichloropyridine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cnc(Cl)c(Cl)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10Cl2F3N3O2/c1-7(24)22-9-2-3-12(10(5-9)15(18,19)20)23-14(25)8-4-11(16)13(17)21-6-8/h2-6H,1H3,(H,22,24)(H,23,25) |
| InChIKey | OUBXDSGIRIWGIX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|