C17H16Cl3N3O3 — CID 46694004
[1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 46694004) has the molecular formula C17H16Cl3N3O3 and a molecular weight of 416.69 g/mol. Its IUPAC name is [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46694004 |
| Molecular Formula | C17H16Cl3N3O3 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)OC(C)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl3N3O3/c1-9-11(16(20)23(3)22-9)7-8-14(24)26-10(2)17(25)21-13-6-4-5-12(18)15(13)19/h4-8,10H,1-3H3,(H,21,25)/b8-7+ |
| InChIKey | GVVYKJKYUQPQOZ-BQYQJAHWSA-N |
| XLogP | 4.27 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|