C19H19ClN4O3 — CID 8957244
[(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 8957244) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is [(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8957244 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)O[C@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClN4O3/c1-11-16(12(2)24(4)23-11)7-8-18(25)27-13(3)19(26)22-15-6-5-14(10-21)17(20)9-15/h5-9,13H,1-4H3,(H,22,26)/b8-7+/t13-/m1/s1 |
| InChIKey | GKTDJNLISGHSQN-SBDDDAINSA-N |
| XLogP | 3.15 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|