C20H22N4S2 — CID 4670050
1-(2,6-diethylphenyl)-3-[[4-(thiadiazol-4-yl)phenyl]methyl]thiourea (PubChem CID 4670050) has the molecular formula C20H22N4S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[[4-(thiadiazol-4-yl)phenyl]methyl]thiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[[4-(thiadiazol-4-yl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 4670050 |
| Molecular Formula | C20H22N4S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[[4-(thiadiazol-4-yl)phenyl]methyl]thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NCc1ccc(-c2csnn2)cc1 |
| InChI | InChI=1S/C20H22N4S2/c1-3-15-6-5-7-16(4-2)19(15)22-20(25)21-12-14-8-10-17(11-9-14)18-13-26-24-23-18/h5-11,13H,3-4,12H2,1-2H3,(H2,21,22,25) |
| InChIKey | YVEOAJXJGZYDPV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|