C24H16ClNO3 — CID 46702727
4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol (PubChem CID 46702727) has the molecular formula C24H16ClNO3 and a molecular weight of 401.85 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol.
| Compound Name | 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol |
|---|---|
| PubChem CID | 46702727 |
| Molecular Formula | C24H16ClNO3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol |
| SMILES | Oc1ccc2oc3ncc(OCc4ccccc4)c(-c4cccc(Cl)c4)c3c2c1 |
| InChI | InChI=1S/C24H16ClNO3/c25-17-8-4-7-16(11-17)22-21(28-14-15-5-2-1-3-6-15)13-26-24-23(22)19-12-18(27)9-10-20(19)29-24/h1-13,27H,14H2 |
| InChIKey | FDZGNOBUUDIZIX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |