About 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol
4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol (PubChem CID 46702727) has the molecular formula C24H16ClNO3
and a molecular weight of 401.85 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol |
| PubChem CID | 46702727 |
| Molecular Formula | C24H16ClNO3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol |
| SMILES | Oc1ccc2oc3ncc(OCc4ccccc4)c(-c4cccc(Cl)c4)c3c2c1 |
| InChI | InChI=1S/C24H16ClNO3/c25-17-8-4-7-16(11-17)22-21(28-14-15-5-2-1-3-6-15)13-26-24-23(22)19-12-18(27)9-10-20(19)29-24/h1-13,27H,14H2 |
| InChIKey | FDZGNOBUUDIZIX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol?
The IUPAC name of 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol (CID 46702727) is 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol.
What is the SMILES notation for 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol?
The canonical SMILES for 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol is Oc1ccc2oc3ncc(OCc4ccccc4)c(-c4cccc(Cl)c4)c3c2c1.
What is the InChIKey of 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol?
The InChIKey is FDZGNOBUUDIZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16ClNO3/c25-17-8-4-7-16(11-17)22-21(28-14-15-5-2-1-3-6-15)13-26-24-23(22)19-12-18(27)9-10-20(19)29-24/h1-13,27H,14H2.
What are the key properties of 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol?
4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol has a molecular weight of 401.85 g/mol, XLogP of 6.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-3-phenylmethoxy-[1]benzofuro[2,3-b]pyridin-6-ol is sourced from PubChem (CID 46702727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).