C14H21NO6 — CID 46704326
methyl (3R,6R,7R,7aR)-3-tert-butyl-7-hydroxy-7-methyl-5-oxospiro[1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6,2'-oxirane]-7a-carboxylate (PubChem CID 46704326) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is methyl (3R,6R,7R,7aR)-3-tert-butyl-7-hydroxy-7-methyl-5-oxospiro[1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6,2'-oxirane]-7a-carboxylate.
| Compound Name | methyl (3R,6R,7R,7aR)-3-tert-butyl-7-hydroxy-7-methyl-5-oxospiro[1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6,2'-oxirane]-7a-carboxylate |
|---|---|
| PubChem CID | 46704326 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | methyl (3R,6R,7R,7aR)-3-tert-butyl-7-hydroxy-7-methyl-5-oxospiro[1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6,2'-oxirane]-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)[C@@]1(CO1)[C@]2(C)O |
| InChI | InChI=1S/C14H21NO6/c1-11(2,3)9-15-8(16)14(7-21-14)12(4,18)13(15,6-20-9)10(17)19-5/h9,18H,6-7H2,1-5H3/t9-,12-,13+,14+/m1/s1 |
| InChIKey | OWEWHPQGKANOAW-QQUHWDOBSA-N |
| XLogP | -0.34 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|