C26H34N2O2S — CID 4672299
[1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] adamantane-1-carboxylate (PubChem CID 4672299) has the molecular formula C26H34N2O2S and a molecular weight of 438.64 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] adamantane-1-carboxylate.
| Compound Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 4672299 |
| Molecular Formula | C26H34N2O2S |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] adamantane-1-carboxylate |
| SMILES | Cc1ccc(Sc2c(C)nn(C(C)(C)C)c2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H34N2O2S/c1-16-6-8-21(9-7-16)31-22-17(2)27-28(25(3,4)5)23(22)30-24(29)26-13-18-10-19(14-26)12-20(11-18)15-26/h6-9,18-20H,10-15H2,1-5H3 |
| InChIKey | OVSHHFQRTYTHRB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |