C14H9N3OS — CID 46731752
2-cyano-N-(3-cyano-4-phenylthiophen-2-yl)acetamide (PubChem CID 46731752) has the molecular formula C14H9N3OS and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-cyano-N-(3-cyano-4-phenylthiophen-2-yl)acetamide.
| Compound Name | 2-cyano-N-(3-cyano-4-phenylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 46731752 |
| Molecular Formula | C14H9N3OS |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-cyano-N-(3-cyano-4-phenylthiophen-2-yl)acetamide |
| SMILES | N#CCC(=O)Nc1scc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C14H9N3OS/c15-7-6-13(18)17-14-11(8-16)12(9-19-14)10-4-2-1-3-5-10/h1-5,9H,6H2,(H,17,18) |
| InChIKey | OAHOSHCNXQISKC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |