C10H5Cl3N2OS — CID 46735501
3-chloro-5-(3,5-dichlorophenyl)-1,2-thiazole-4-carboxamide (PubChem CID 46735501) has the molecular formula C10H5Cl3N2OS and a molecular weight of 307.59 g/mol. Its IUPAC name is 3-chloro-5-(3,5-dichlorophenyl)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-chloro-5-(3,5-dichlorophenyl)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46735501 |
| Molecular Formula | C10H5Cl3N2OS |
| Molecular Weight | 307.59 g/mol |
| Exact Mass | 305.92 |
| IUPAC Name | 3-chloro-5-(3,5-dichlorophenyl)-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(Cl)nsc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H5Cl3N2OS/c11-5-1-4(2-6(12)3-5)8-7(10(14)16)9(13)15-17-8/h1-3H,(H2,14,16) |
| InChIKey | MLBYWMGLZYPTPB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |