C26H33N3O3 — CID 4676190
3-[(7-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 4676190) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-[(7-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 3-[(7-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 4676190 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 3-[(7-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | Cc1ccc2c(c1)OCC(=O)N2Cc1cccc(C(=O)NCCCN2CCCCC2C)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-19-10-11-23-24(15-19)32-18-25(30)29(23)17-21-8-5-9-22(16-21)26(31)27-12-6-14-28-13-4-3-7-20(28)2/h5,8-11,15-16,20H,3-4,6-7,12-14,17-18H2,1-2H3,(H,27,31) |
| InChIKey | LVKGLXUWSAVGSK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|