C21H31N3O3 — CID 7415487
3-(7-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]propanamide (PubChem CID 7415487) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-(7-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]propanamide.
| Compound Name | 3-(7-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 7415487 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 3-(7-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]propanamide |
| SMILES | Cc1ccc2c(c1)OCC(=O)N2CCC(=O)NCCCN1CCCC[C@H]1C |
| InChI | InChI=1S/C21H31N3O3/c1-16-7-8-18-19(14-16)27-15-21(26)24(18)13-9-20(25)22-10-5-12-23-11-4-3-6-17(23)2/h7-8,14,17H,3-6,9-13,15H2,1-2H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | VOUZKAHHDHUFTE-QGZVFWFLSA-N |
| XLogP | 2.49 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|