C23H28N2O4 — CID 46762320
(Z)-2-acetamido-N-[(4-butoxy-3-methoxyphenyl)methyl]-3-phenylprop-2-enamide (PubChem CID 46762320) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (Z)-2-acetamido-N-[(4-butoxy-3-methoxyphenyl)methyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-acetamido-N-[(4-butoxy-3-methoxyphenyl)methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 46762320 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (Z)-2-acetamido-N-[(4-butoxy-3-methoxyphenyl)methyl]-3-phenylprop-2-enamide |
| SMILES | CCCCOc1ccc(CNC(=O)/C(=C/c2ccccc2)NC(C)=O)cc1OC |
| InChI | InChI=1S/C23H28N2O4/c1-4-5-13-29-21-12-11-19(15-22(21)28-3)16-24-23(27)20(25-17(2)26)14-18-9-7-6-8-10-18/h6-12,14-15H,4-5,13,16H2,1-3H3,(H,24,27)(H,25,26)/b20-14- |
| InChIKey | UPWFZZIIXMAGEU-ZHZULCJRSA-N |
| XLogP | 3.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|