C20H19F3N2O3 — CID 34501494
(Z)-2-acetamido-3-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 34501494) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is (Z)-2-acetamido-3-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (Z)-2-acetamido-3-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 34501494 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (Z)-2-acetamido-3-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)NCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c1-14(26)25-18(11-15-5-3-2-4-6-15)19(27)24-12-16-7-9-17(10-8-16)28-13-20(21,22)23/h2-11H,12-13H2,1H3,(H,24,27)(H,25,26)/b18-11- |
| InChIKey | VVYFGLCUPNAFAN-WQRHYEAKSA-N |
| XLogP | 3.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|