C24H30N2O4S — CID 46776102
6-tert-butyl-4-methylsulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 46776102) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is 6-tert-butyl-4-methylsulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-tert-butyl-4-methylsulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 46776102 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 6-tert-butyl-4-methylsulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(S(C)(=O)=O)CC(C(=O)NC1CCCc3ccccc31)O2 |
| InChI | InChI=1S/C24H30N2O4S/c1-24(2,3)17-12-13-21-20(14-17)26(31(4,28)29)15-22(30-21)23(27)25-19-11-7-9-16-8-5-6-10-18(16)19/h5-6,8,10,12-14,19,22H,7,9,11,15H2,1-4H3,(H,25,27) |
| InChIKey | PYOXXQUACPBWOO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |