C25H23ClN2O4S — CID 43886163
4-(4-chlorophenyl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 43886163) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 43886163 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(NC1CCCc2ccccc21)C1CN(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C25H23ClN2O4S/c26-18-12-14-19(15-13-18)33(30,31)28-16-24(32-23-11-4-3-10-22(23)28)25(29)27-21-9-5-7-17-6-1-2-8-20(17)21/h1-4,6,8,10-15,21,24H,5,7,9,16H2,(H,27,29) |
| InChIKey | MZVDIPKRHVIDGJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |