C26H26N2O4S — CID 94012556
(2S)-4-benzylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 94012556) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is (2S)-4-benzylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-benzylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 94012556 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (2S)-4-benzylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CN(S(=O)(=O)Cc2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C26H26N2O4S/c29-26(27-22-14-8-12-20-11-4-5-13-21(20)22)25-17-28(23-15-6-7-16-24(23)32-25)33(30,31)18-19-9-2-1-3-10-19/h1-7,9-11,13,15-16,22,25H,8,12,14,17-18H2,(H,27,29)/t22-,25+/m1/s1 |
| InChIKey | PNRANISCPZBSPB-RDGATRHJSA-N |
| XLogP | 3.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |