C43H53N2O+ — CID 46783890
2-[(E)-2-[(3E)-2-(4-butoxyphenyl)-5-methyl-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium (PubChem CID 46783890) has the molecular formula C43H53N2O+ and a molecular weight of 613.91 g/mol. Its IUPAC name is 2-[(E)-2-[(3E)-2-(4-butoxyphenyl)-5-methyl-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium.
| Compound Name | 2-[(E)-2-[(3E)-2-(4-butoxyphenyl)-5-methyl-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium |
|---|---|
| PubChem CID | 46783890 |
| Molecular Formula | C43H53N2O+ |
| Molecular Weight | 613.91 g/mol |
| Exact Mass | 613.42 |
| IUPAC Name | 2-[(E)-2-[(3E)-2-(4-butoxyphenyl)-5-methyl-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium |
| SMILES | CCCCOc1ccc(C2=C(/C=C/C3=[N+](C)c4ccccc4C3(C)C)CC(C)C/C2=C\C=C2\N(C)C3=C(C=CCC3)C2(C)C)cc1 |
| InChI | InChI=1S/C43H53N2O/c1-9-10-27-46-34-23-19-31(20-24-34)41-32(21-25-39-42(3,4)35-15-11-13-17-37(35)44(39)7)28-30(2)29-33(41)22-26-40-43(5,6)36-16-12-14-18-38(36)45(40)8/h11-13,15-17,19-26,30H,9-10,14,18,27-29H2,1-8H3/q+1 |
| InChIKey | BTYNPLRGRQXTEO-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.91 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|