C32H38ClN2+ — CID 46783934
2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium (PubChem CID 46783934) has the molecular formula C32H38ClN2+ and a molecular weight of 486.12 g/mol. Its IUPAC name is 2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium.
| Compound Name | 2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium |
|---|---|
| PubChem CID | 46783934 |
| Molecular Formula | C32H38ClN2+ |
| Molecular Weight | 486.12 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-(1,3,3-trimethyl-6,7-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethylindol-1-ium |
| SMILES | CN1C2=C(C=CCC2)C(C)(C)/C1=C\C=C1/CCCC(/C=C/C2=[N+](C)c3ccccc3C2(C)C)=C1Cl |
| InChI | InChI=1S/C32H38ClN2/c1-31(2)24-14-7-9-16-26(24)34(5)28(31)20-18-22-12-11-13-23(30(22)33)19-21-29-32(3,4)25-15-8-10-17-27(25)35(29)6/h7-9,14-16,18-21H,10-13,17H2,1-6H3/q+1 |
| InChIKey | OWVHMPQEMRKJJN-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.12 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|