C8H14N2OS — CID 46784200
2-methoxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 46784200) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-methoxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 46784200 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-methoxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | COCCNCc1ncc(C)s1 |
| InChI | InChI=1S/C8H14N2OS/c1-7-5-10-8(12-7)6-9-3-4-11-2/h5,9H,3-4,6H2,1-2H3 |
| InChIKey | YAQLIKOQBFJZQF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|