C28H26ClN3O2S2 — CID 4679680
3-(3-chloro-4-methylphenyl)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4679680) has the molecular formula C28H26ClN3O2S2 and a molecular weight of 536.12 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3-chloro-4-methylphenyl)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4679680 |
| Molecular Formula | C28H26ClN3O2S2 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-n2c(SCC(=O)N3c4ccccc4CC3C)nc3sc4c(c3c2=O)CCCC4)cc1Cl |
| InChI | InChI=1S/C28H26ClN3O2S2/c1-16-11-12-19(14-21(16)29)32-27(34)25-20-8-4-6-10-23(20)36-26(25)30-28(32)35-15-24(33)31-17(2)13-18-7-3-5-9-22(18)31/h3,5,7,9,11-12,14,17H,4,6,8,10,13,15H2,1-2H3 |
| InChIKey | FEEDLINWWURAIN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |