C22H23N3OS2 — CID 1374006
1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]ethanone (PubChem CID 1374006) has the molecular formula C22H23N3OS2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]ethanone.
| Compound Name | 1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 1374006 |
| Molecular Formula | C22H23N3OS2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]ethanone |
| SMILES | Cc1nc(SCC(=O)N2c3ccccc3C[C@@H]2C)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C22H23N3OS2/c1-13-11-15-7-3-5-9-17(15)25(13)19(26)12-27-21-20-16-8-4-6-10-18(16)28-22(20)24-14(2)23-21/h3,5,7,9,13H,4,6,8,10-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | JBTIPPLEEBVFSU-ZDUSSCGKSA-N |
| XLogP | 4.95 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |