C27H25N3O2S2 — CID 3301294
2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3301294) has the molecular formula C27H25N3O2S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3301294 |
| Molecular Formula | C27H25N3O2S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1Cc2ccccc2N1C(=O)CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCCC3 |
| InChI | InChI=1S/C27H25N3O2S2/c1-17-15-18-9-5-7-13-21(18)29(17)23(31)16-33-27-28-25-24(20-12-6-8-14-22(20)34-25)26(32)30(27)19-10-3-2-4-11-19/h2-5,7,9-11,13,17H,6,8,12,14-16H2,1H3 |
| InChIKey | PJBCBTDTKDRHNI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |