C20H19N3OS2 — CID 2385126
1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone (PubChem CID 2385126) has the molecular formula C20H19N3OS2 and a molecular weight of 381.53 g/mol. Its IUPAC name is 1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone.
| Compound Name | 1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 2385126 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)CSc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C20H19N3OS2/c1-12-9-13-5-2-3-7-15(13)23(12)17(24)10-25-19-18-14-6-4-8-16(14)26-20(18)22-11-21-19/h2-3,5,7,11-12H,4,6,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | RYDZBTMPYDYUEJ-GFCCVEGCSA-N |
| XLogP | 4.25 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |