C22H23ClF3N3O4 — CID 46798262
(E)-1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 46798262) has the molecular formula C22H23ClF3N3O4 and a molecular weight of 485.89 g/mol. Its IUPAC name is (E)-1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46798262 |
| Molecular Formula | C22H23ClF3N3O4 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (E)-1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C22H23ClF3N3O4/c1-31-17-12-19(33-3)18(32-2)10-14(17)4-5-20(30)28-6-8-29(9-7-28)21-16(23)11-15(13-27-21)22(24,25)26/h4-5,10-13H,6-9H2,1-3H3/b5-4+ |
| InChIKey | QDLSZQSSICMZLS-SNAWJCMRSA-N |
| XLogP | 4.14 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|