C14H23N3OS2 — CID 46800506
1-(2-methyl-2-morpholin-4-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 46800506) has the molecular formula C14H23N3OS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(2-methyl-2-morpholin-4-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 46800506 |
| Molecular Formula | C14H23N3OS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | CC(C)(CNC(=S)NCc1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C14H23N3OS2/c1-14(2,17-5-7-18-8-6-17)11-16-13(19)15-10-12-4-3-9-20-12/h3-4,9H,5-8,10-11H2,1-2H3,(H2,15,16,19) |
| InChIKey | DMERXKHOPKEOIQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|